CAS 181069-80-7 is the registry number for Alagebrium (bromide). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide (CAS 181069-80-7) is a chemical compound with the molecular formula C13H14BrNOS and a molecular weight of 312.23 g/mol. IUPAC name: 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide. InChIKey: NWYBJPXXICNVLX-UHFFFAOYSA-M.
| Molecular formula | C13H14BrNOS |
|---|---|
| Molecular weight | 312.23 g/mol |
| IUPAC name | 2-(4,5-dimethyl-1,3-thiazol-3-ium-3-yl)-1-phenylethanone bromide |
| InChIKey | NWYBJPXXICNVLX-UHFFFAOYSA-M |
| SMILES | CC1=C(SC=[N+]1CC(=O)C2=CC=CC=C2)C.[Br-] |
Computed by PubChem (NCBI)