CAS 1810706-88-7 is the registry number for 4-Formylphenyl sulfofluoridate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-fluorosulfonyloxy-4-formylbenzene (CAS 1810706-88-7) is a chemical compound with the molecular formula C7H5FO4S and a molecular weight of 204.18 g/mol. IUPAC name: 1-fluorosulfonyloxy-4-formylbenzene. InChIKey: STWYQXZIOTWRQZ-UHFFFAOYSA-N.
| Molecular formula | C7H5FO4S |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 1-fluorosulfonyloxy-4-formylbenzene |
| InChIKey | STWYQXZIOTWRQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OS(=O)(=O)F |
Computed by PubChem (NCBI)