CAS 18109-81-4 appears in our catalog under these names: Butamirate citrate, 95%, Butamirate Citrate, Butamirate Citrate, >95% (HPLC), Butamirate citrate, Butamirate (citrate) (Standard). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 1g, 25g, 5g, on request, 100mg, 10mg, 50mg, 250mg.
2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (CAS 18109-81-4) is a chemical compound with the molecular formula C24H37NO10 and a molecular weight of 499.6 g/mol. IUPAC name: 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid. InChIKey: JVKMHUAWFDGPTF-UHFFFAOYSA-N.
| Molecular formula | C24H37NO10 |
|---|---|
| Molecular weight | 499.6 g/mol |
| IUPAC name | 2-[2-(diethylamino)ethoxy]ethyl 2-phenylbutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| InChIKey | JVKMHUAWFDGPTF-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC=CC=C1)C(=O)OCCOCCN(CC)CC.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)