CAS 181141-44-6 appears in our catalog under these names: tert-Butyl rac-(3ar,4s,7as)-octahydro-1h-isoindol-4-ylcarbamate hydrochloride, 95%, Rel-tert-butyl ((3aR,4R,7aS)-octahydro-1H-isoindol-4-yl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
Tert-butyl N-[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]carbamate (CAS 181141-44-6) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl N-[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]carbamate. InChIKey: XMYGQAXKEOMNDO-OUAUKWLOSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl N-[(3aR,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-4-yl]carbamate |
| InChIKey | XMYGQAXKEOMNDO-OUAUKWLOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H]2[C@@H]1CNC2 |
Computed by PubChem (NCBI)