CAS 181190-33-0 is the registry number for N-(4-chloro-2-(2,2,2-trifluoroacetyl)phenyl)pivalamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-2,2-dimethylpropanamide (CAS 181190-33-0) is a chemical compound with the molecular formula C13H13ClF3NO2 and a molecular weight of 307.69 g/mol. IUPAC name: N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-2,2-dimethylpropanamide. InChIKey: PPPQKMYILLVLDD-UHFFFAOYSA-N.
| Molecular formula | C13H13ClF3NO2 |
|---|---|
| Molecular weight | 307.69 g/mol |
| IUPAC name | N-[4-chloro-2-(2,2,2-trifluoroacetyl)phenyl]-2,2-dimethylpropanamide |
| InChIKey | PPPQKMYILLVLDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=C1)Cl)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)