Products 1812179-53-5

CAS 1812179-53-5 is the registry number for (2S)-2-(2-Aminoacetamido)pentanedioic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2S)-2-[(2-aminoacetyl)amino]pentanedioic acid;hydrochloride (CAS 1812179-53-5) is a chemical compound with the molecular formula C7H13ClN2O5 and a molecular weight of 240.64 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]pentanedioic acid;hydrochloride. InChIKey: AGZCTDUUSFCPMD-WCCKRBBISA-N.

Identity
Molecular formulaC7H13ClN2O5
Molecular weight240.64 g/mol
IUPAC name(2S)-2-[(2-aminoacetyl)amino]pentanedioic acid;hydrochloride
InChIKeyAGZCTDUUSFCPMD-WCCKRBBISA-N
SMILESC(CC(=O)O)[C@@H](C(=O)O)NC(=O)CN.Cl

Computed by PubChem (NCBI)