CAS 1812220-08-8 is the registry number for 8-chloro-3-iodo-1,4-dihydro-1,7-naphthyridin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-3-iodo-1H-1,7-naphthyridin-4-one (CAS 1812220-08-8) is a chemical compound with the molecular formula C8H4ClIN2O and a molecular weight of 306.49 g/mol. IUPAC name: 8-chloro-3-iodo-1H-1,7-naphthyridin-4-one. InChIKey: NLGGYFWMGUKJJI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClIN2O |
|---|---|
| Molecular weight | 306.49 g/mol |
| IUPAC name | 8-chloro-3-iodo-1H-1,7-naphthyridin-4-one |
| InChIKey | NLGGYFWMGUKJJI-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=O)C(=CN2)I)Cl |
Computed by PubChem (NCBI)