Products 1812220-39-5
CAS 1812220-39-5 is the registry number for rel-(2-((2R,6S)-2,6-Dimethylmorpholino)pyrimidin-5-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]boronic acid (CAS 1812220-39-5) is a chemical compound with the molecular formula C10H16BN3O3 and a molecular weight of 237.07 g/mol. IUPAC name: [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]boronic acid. InChIKey: LQWCZMTUSIKNQK-OCAPTIKFSA-N.
| Molecular formula | C10H16BN3O3 |
|---|---|
| Molecular weight | 237.07 g/mol |
| IUPAC name | [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]boronic acid |
| InChIKey | LQWCZMTUSIKNQK-OCAPTIKFSA-N |
| SMILES | B(C1=CN=C(N=C1)N2C[C@H](O[C@H](C2)C)C)(O)O |
Computed by PubChem (NCBI)