CAS 181274-15-7 appears in our catalog under these names: Propoxycarbazone Sodium Salt, >95% (HPLC), Propoxycarbazone sodium, Propoxycarbazone sodium 10 µg/mL in Acetonitrile, Propoxycarbazone sodium 100 µg/mL in Acetonitrile, Propoxycarbazone sodium salt. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 250mg, 500mg, 10ml, 1ml, 50MG, 50 mg, 500 mg.
Sodium (2-methoxycarbonylphenyl)sulfonyl-(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)azanide (CAS 181274-15-7) is a chemical compound with the molecular formula C15H17N4NaO7S and a molecular weight of 420.4 g/mol. IUPAC name: sodium (2-methoxycarbonylphenyl)sulfonyl-(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)azanide. InChIKey: JRQGDDUXDKCWRF-UHFFFAOYSA-M.
| Molecular formula | C15H17N4NaO7S |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | sodium (2-methoxycarbonylphenyl)sulfonyl-(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)azanide |
| InChIKey | JRQGDDUXDKCWRF-UHFFFAOYSA-M |
| SMILES | CCCOC1=NN(C(=O)N1C)C(=O)[N-]S(=O)(=O)C2=CC=CC=C2C(=O)OC.[Na+] |
Computed by PubChem (NCBI)