CAS 181289-33-8 appears in our catalog under these names: (R)-(-)-3-Carbamoymethyl-5-methylhexanoic acid, 95%, Pregabalin Impurity 94, (R)-(-)-3-(Carbamoylmethyl)-5-methylhexanoic acid, >95% (HPLC), (R)-3-(Carbamoylmethyl)-5-methylhexanoic Acid, (R)–(–)–3–Carbamoymethyl–5–methylhexanoic acid. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 25g, 5g, 100g, 1g, on request, 100mg, 25mg, 500g.
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid (CAS 181289-33-8) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid. InChIKey: NPDKTSLVWGFPQG-SSDOTTSWSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid |
| InChIKey | NPDKTSLVWGFPQG-SSDOTTSWSA-N |
| SMILES | CC(C)C[C@H](CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)