Products 181289-36-1

CAS 181289-36-1 is the registry number for Pregabalin Impurity 62. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

(3R)-3-cyano-5-methylhexanoic acid (CAS 181289-36-1) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (3R)-3-cyano-5-methylhexanoic acid. InChIKey: MGWZYUMZVZMKTN-SSDOTTSWSA-N.

Identity
Molecular formulaC8H13NO2
Molecular weight155.19 g/mol
IUPAC name(3R)-3-cyano-5-methylhexanoic acid
InChIKeyMGWZYUMZVZMKTN-SSDOTTSWSA-N
SMILESCC(C)C[C@H](CC(=O)O)C#N

Computed by PubChem (NCBI)