CAS 18132-72-4 appears in our catalog under these names: 1,3-Bis(3-chloropropyl)-1,1,3,3-tetramethyldisiloxane, 1,3-Bis(3-chloropropyl)tetramethyldisiloxane. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
3-chloropropyl-[3-chloropropyl(dimethyl)silyl]oxy-dimethylsilane (CAS 18132-72-4) is a chemical compound with the molecular formula C10H24Cl2OSi2 and a molecular weight of 287.37 g/mol. IUPAC name: 3-chloropropyl-[3-chloropropyl(dimethyl)silyl]oxy-dimethylsilane. InChIKey: OILWIZSTLQQEBD-UHFFFAOYSA-N.
| Molecular formula | C10H24Cl2OSi2 |
|---|---|
| Molecular weight | 287.37 g/mol |
| IUPAC name | 3-chloropropyl-[3-chloropropyl(dimethyl)silyl]oxy-dimethylsilane |
| InChIKey | OILWIZSTLQQEBD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCCCl)O[Si](C)(C)CCCCl |
Computed by PubChem (NCBI)