Products 1814-40-0

CAS 1814-40-0 is the registry number for Tris(1h,1h,9h-perfluorononyl)borate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Tris(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl) borate (CAS 1814-40-0) is a chemical compound with the molecular formula C27H9BF48O3 and a molecular weight of 1304.1 g/mol. IUPAC name: tris(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl) borate. InChIKey: NPGAFGTUBPUCCI-UHFFFAOYSA-N.

Identity
Molecular formulaC27H9BF48O3
Molecular weight1304.1 g/mol
IUPAC nametris(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl) borate
InChIKeyNPGAFGTUBPUCCI-UHFFFAOYSA-N
SMILESB(OCC(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(OCC(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)OCC(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F

Computed by PubChem (NCBI)