CAS 1814901-04-6 appears in our catalog under these names: Acid-apeg6-acid, 95%, NH–bis(PEG3–acid), NH-bis(PEG3-acid) hydrochloride, 4,7,10,16,19,22-Hexaoxa-13-azapentacosanedioic acid, 95%, 95%, NH-bis(PEG3-acid). Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 100mg, 100 mg, 250 mg, 10 mg, 50 mg.
3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1814901-04-6) is a chemical compound with the molecular formula C18H35NO10 and a molecular weight of 425.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SOBFCIHPQNRZEE-UHFFFAOYSA-N.
| Molecular formula | C18H35NO10 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethylamino]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SOBFCIHPQNRZEE-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCNCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)