CAS 1814939-13-3 is the registry number for 2-Carboxypyrimidine-5-boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
5-boronopyrimidine-2-carboxylic acid (CAS 1814939-13-3) is a chemical compound with the molecular formula C5H5BN2O4 and a molecular weight of 167.92 g/mol. IUPAC name: 5-boronopyrimidine-2-carboxylic acid. InChIKey: LVFZDVKAXITDBK-UHFFFAOYSA-N.
| Molecular formula | C5H5BN2O4 |
|---|---|
| Molecular weight | 167.92 g/mol |
| IUPAC name | 5-boronopyrimidine-2-carboxylic acid |
| InChIKey | LVFZDVKAXITDBK-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)