CAS 181495-36-3 is the registry number for Rac-(1r,2r)-2-(benzyloxy)cyclopentan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine (CAS 181495-36-3) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine. InChIKey: JIMSXLUBRRQALI-VXGBXAGGSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | trans-(1R,2R)-2-phenylmethoxycyclopentan-1-amine |
| InChIKey | JIMSXLUBRRQALI-VXGBXAGGSA-N |
| SMILES | C1C[C@H]([C@@H](C1)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)