CAS 18151-53-6 appears in our catalog under these names: Thexyltrichlorosilane, 95%, Trichloro(2,3–dimethylbutan–2–yl)silane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 25g, 1g.
Trichloro(2,3-dimethylbutan-2-yl)silane (CAS 18151-53-6) is a chemical compound with the molecular formula C6H13Cl3Si and a molecular weight of 219.6 g/mol. IUPAC name: trichloro(2,3-dimethylbutan-2-yl)silane. InChIKey: OMLLOLAFIFULFX-UHFFFAOYSA-N.
| Molecular formula | C6H13Cl3Si |
|---|---|
| Molecular weight | 219.6 g/mol |
| IUPAC name | trichloro(2,3-dimethylbutan-2-yl)silane |
| InChIKey | OMLLOLAFIFULFX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(C)[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)