Products 181516-92-7
CAS 181516-92-7 appears in our catalog under these names: 5-Hydroxycytosine-13C, 15N2, 5-Hydroxycytosine-13C,15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 1 mg.
6-amino-5-hydroxy-(213C,1,3-15N2)1H-pyrimidin-2-one (CAS 181516-92-7) is a chemical compound with the molecular formula C4H5N3O2 and a molecular weight of 130.08 g/mol. IUPAC name: 6-amino-5-hydroxy-(213C,1,3-15N2)1H-pyrimidin-2-one. InChIKey: NLLCDONDZDHLCI-XZQGXACKSA-N.
| Molecular formula | C4H5N3O2 |
|---|---|
| Molecular weight | 130.08 g/mol |
| IUPAC name | 6-amino-5-hydroxy-(213C,1,3-15N2)1H-pyrimidin-2-one |
| InChIKey | NLLCDONDZDHLCI-XZQGXACKSA-N |
| SMILES | C1=[15N][13C](=O)[15NH]C(=C1O)N |
Computed by PubChem (NCBI)