CAS 181517-13-5 is the registry number for 5-Bromouracil 2-13C,15N2, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
5-bromo-(213C,1,3-15N2)1H-pyrimidine-2,4-dione (CAS 181517-13-5) is a chemical compound with the molecular formula C4H3BrN2O2 and a molecular weight of 193.96 g/mol. IUPAC name: 5-bromo-(213C,1,3-15N2)1H-pyrimidine-2,4-dione. InChIKey: LQLQRFGHAALLLE-XZQGXACKSA-N.
| Molecular formula | C4H3BrN2O2 |
|---|---|
| Molecular weight | 193.96 g/mol |
| IUPAC name | 5-bromo-(213C,1,3-15N2)1H-pyrimidine-2,4-dione |
| InChIKey | LQLQRFGHAALLLE-XZQGXACKSA-N |
| SMILES | C1=C(C(=O)[15NH][13C](=O)[15NH]1)Br |
Computed by PubChem (NCBI)