CAS 181528-64-3 appears in our catalog under these names: Artemether Impurity 4, Artemether Impurity 2, Artemether Tetrahydrofuran Acetate, >95% (GC), Artemether Tetrahydrofuran Acetate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 25mg, 5mg, 10mg, 50mg.
[(3aS,4R,6aS,7R,8S,10R,10aR)-8-methoxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate (CAS 181528-64-3) is a chemical compound with the molecular formula C16H26O5 and a molecular weight of 298.37 g/mol. IUPAC name: [(3aS,4R,6aS,7R,8S,10R,10aR)-8-methoxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate. InChIKey: PJRDDUABDHLSPP-QYHITDJBSA-N.
| Molecular formula | C16H26O5 |
|---|---|
| Molecular weight | 298.37 g/mol |
| IUPAC name | [(3aS,4R,6aS,7R,8S,10R,10aR)-8-methoxy-4,7-dimethyl-2,3,3a,4,5,6,6a,7,8,10-decahydrofuro[3,2-i]isochromen-10-yl] acetate |
| InChIKey | PJRDDUABDHLSPP-QYHITDJBSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@@H]([C@@]23[C@H]1CCO3)OC(=O)C)OC)C |
Computed by PubChem (NCBI)