CAS 181528-84-7 is the registry number for 1-Isocyano-2-methoxy-2-methyl-propane-d3. Offered by: TRC. Available pack sizes: 50mg.
1-isocyano-2-methyl-2-(trideuteriomethoxy)propane (CAS 181528-84-7) is a chemical compound with the molecular formula C6H11NO and a molecular weight of 116.18 g/mol. IUPAC name: 1-isocyano-2-methyl-2-(trideuteriomethoxy)propane. InChIKey: LJJFNFYPZOHRHM-GKOSEXJESA-N.
| Molecular formula | C6H11NO |
|---|---|
| Molecular weight | 116.18 g/mol |
| IUPAC name | 1-isocyano-2-methyl-2-(trideuteriomethoxy)propane |
| InChIKey | LJJFNFYPZOHRHM-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])OC(C)(C)C[N+]#[C-] |
Computed by PubChem (NCBI)