CAS 18164-03-9 is the registry number for Phenylsilane-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
Trideuterio(phenyl)silane (CAS 18164-03-9) is a chemical compound with the molecular formula C6H8Si and a molecular weight of 111.23 g/mol. IUPAC name: trideuterio(phenyl)silane. InChIKey: PARWUHTVGZSQPD-UKDQJQFQSA-N.
| Molecular formula | C6H8Si |
|---|---|
| Molecular weight | 111.23 g/mol |
| IUPAC name | trideuterio(phenyl)silane |
| InChIKey | PARWUHTVGZSQPD-UKDQJQFQSA-N |
| SMILES | [2H][Si]([2H])([2H])C1=CC=CC=C1 |
Computed by PubChem (NCBI)