CAS 181705-93-1 appears in our catalog under these names: 4-Fluorophenylzinc bromide, 0.5M in THF, packaged under Argo, 4-FLUOROPHENYLZINC BROMIDE, 0.5M SOLUTI&. Offered by: Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 50ml.
Bromozinc(1+);fluorobenzene (CAS 181705-93-1) is a chemical compound with the molecular formula C6H4BrFZn and a molecular weight of 240.4 g/mol. IUPAC name: bromozinc(1+);fluorobenzene. InChIKey: VRJVWWPYGMESMA-UHFFFAOYSA-M.
| Molecular formula | C6H4BrFZn |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | bromozinc(1+);fluorobenzene |
| InChIKey | VRJVWWPYGMESMA-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=[C-]1)F.[Zn+]Br |
Computed by PubChem (NCBI)