CAS 18171-50-1 is the registry number for 1,3–BIS(TRICHLOROSILYL)PROPANE. Offered by: GLPBio. Available pack sizes: 10g.
Trichloro(3-trichlorosilylpropyl)silane (CAS 18171-50-1) is a chemical compound with the molecular formula C3H6Cl6Si2 and a molecular weight of 311.0 g/mol. IUPAC name: trichloro(3-trichlorosilylpropyl)silane. InChIKey: MLDKTCCADNRZEK-UHFFFAOYSA-N.
| Molecular formula | C3H6Cl6Si2 |
|---|---|
| Molecular weight | 311.0 g/mol |
| IUPAC name | trichloro(3-trichlorosilylpropyl)silane |
| InChIKey | MLDKTCCADNRZEK-UHFFFAOYSA-N |
| SMILES | C(C[Si](Cl)(Cl)Cl)C[Si](Cl)(Cl)Cl |
Computed by PubChem (NCBI)