Products 1817605-38-1
CAS 1817605-38-1 appears in our catalog under these names: 5,5'-Oxydiisophthalic acid, 95%, 95%, 5,5'-Oxydiisophthalic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(3,5-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid (CAS 1817605-38-1) is a chemical compound with the molecular formula C16H10O9 and a molecular weight of 346.24 g/mol. IUPAC name: 5-(3,5-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid. InChIKey: WIEQZLBNBUVWSJ-UHFFFAOYSA-N.
| Molecular formula | C16H10O9 |
|---|---|
| Molecular weight | 346.24 g/mol |
| IUPAC name | 5-(3,5-dicarboxyphenoxy)benzene-1,3-dicarboxylic acid |
| InChIKey | WIEQZLBNBUVWSJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)