CAS 1817735-27-5 appears in our catalog under these names: Bromo–PEG5–C2–acid, Bromo-PEG5-C2-acid 98%, Propanoic acid, 3-[(14-bromo-3,6,9,12-tetraoxatetradec-1-yl)oxy]-, 98%, 98%, Bromo-PEG5-C2-acid, 98.0%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 100 mg, 500 mg, 250 mg.
3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1817735-27-5) is a chemical compound with the molecular formula C13H25BrO7 and a molecular weight of 373.24 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QKETVVWJRQCHDS-UHFFFAOYSA-N.
| Molecular formula | C13H25BrO7 |
|---|---|
| Molecular weight | 373.24 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QKETVVWJRQCHDS-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCBr)C(=O)O |
Computed by PubChem (NCBI)