CAS 1817735-29-7 appears in our catalog under these names: Propargyl-peg4-sulfonic acid, 95%, Propargyl–PEG4–sulfonic acid, Propargyl-PEG4-sulfonic acid, Propargyl-PEG4-sulfonic acid 95%, 3,6,9,12-Tetraoxapentadec-14-ynesulfonic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 10mg, 25mg, 50mg, 5g, 1 g.
2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethanesulfonic acid (CAS 1817735-29-7) is a chemical compound with the molecular formula C11H20O7S and a molecular weight of 296.34 g/mol. IUPAC name: 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethanesulfonic acid. InChIKey: WSJYOZNIORDONJ-UHFFFAOYSA-N.
| Molecular formula | C11H20O7S |
|---|---|
| Molecular weight | 296.34 g/mol |
| IUPAC name | 2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethanesulfonic acid |
| InChIKey | WSJYOZNIORDONJ-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCS(=O)(=O)O |
Computed by PubChem (NCBI)