CAS 1817821-22-9 is the registry number for Hydroxy Tyrosol 4-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 0,5mg, 2,5mg, 5mg.
Sodium [2-hydroxy-4-(2-hydroxyethyl)phenyl] sulfate (CAS 1817821-22-9) is a chemical compound with the molecular formula C8H9NaO6S and a molecular weight of 256.21 g/mol. IUPAC name: sodium [2-hydroxy-4-(2-hydroxyethyl)phenyl] sulfate. InChIKey: IITBSVUPUFDGFR-UHFFFAOYSA-M.
| Molecular formula | C8H9NaO6S |
|---|---|
| Molecular weight | 256.21 g/mol |
| IUPAC name | sodium [2-hydroxy-4-(2-hydroxyethyl)phenyl] sulfate |
| InChIKey | IITBSVUPUFDGFR-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1CCO)O)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)