CAS 1817821-33-2 is the registry number for Vanillylacetoxyethyl 4-Sulfate Sodium Salt. Offered by: TRC. Available pack sizes: 100mg.
Sodium [4-(2-acetyloxyethyl)-2-methoxyphenyl] sulfate (CAS 1817821-33-2) is a chemical compound with the molecular formula C11H13NaO7S and a molecular weight of 312.27 g/mol. IUPAC name: sodium [4-(2-acetyloxyethyl)-2-methoxyphenyl] sulfate. InChIKey: KOJODDHRUWLPEM-UHFFFAOYSA-M.
| Molecular formula | C11H13NaO7S |
|---|---|
| Molecular weight | 312.27 g/mol |
| IUPAC name | sodium [4-(2-acetyloxyethyl)-2-methoxyphenyl] sulfate |
| InChIKey | KOJODDHRUWLPEM-UHFFFAOYSA-M |
| SMILES | CC(=O)OCCC1=CC(=C(C=C1)OS(=O)(=O)[O-])OC.[Na+] |
Computed by PubChem (NCBI)