CAS 1818268-45-9 appears in our catalog under these names: Empagliflozin Impurity 101, (5-(4-Fluorophenyl)thiophen-2-yl)(5-iodo-2-methylphenyl)methanol, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
[5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanol (CAS 1818268-45-9) is a chemical compound with the molecular formula C18H14FIOS and a molecular weight of 424.3 g/mol. IUPAC name: [5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanol. InChIKey: NQVHPWTYCPDLIP-UHFFFAOYSA-N.
| Molecular formula | C18H14FIOS |
|---|---|
| Molecular weight | 424.3 g/mol |
| IUPAC name | [5-(4-fluorophenyl)thiophen-2-yl]-(5-iodo-2-methylphenyl)methanol |
| InChIKey | NQVHPWTYCPDLIP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)I)C(C2=CC=C(S2)C3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)