CAS 1818294-29-9 appears in our catalog under these names: Propargyl-peg7-t-butyl ester, 95%, Propargyl–PEG7–Boc, Propargyl-PEG7-Boc 95%, tert-Butyl 4,7,10,13,16,19,22-heptaoxapentacos-24-ynoate, 95%, 95%, Propargyl-PEG7-Boc. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 250 mg, 1 g, 100 mg.
Tert-butyl 3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-29-9) is a chemical compound with the molecular formula C22H40O9 and a molecular weight of 448.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZYHHJKFUMHBJSI-UHFFFAOYSA-N.
| Molecular formula | C22H40O9 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZYHHJKFUMHBJSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)