CAS 1818393-16-6 appears in our catalog under these names: APG 115, Alrizomadlin/ 98.79% (existing batch purity), Alrizomadlin 98%, APG 115, 98%, 98%, Alrizomadlin, 99.24%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
CAS 1818393-16-6 identifies a chemical compound with the molecular formula C34H38Cl2FN3O4 and a molecular weight of 642.6 g/mol. InChIKey: YJCZPJQGFSSFOL-MNZPCBJKSA-N.
| Molecular formula | C34H38Cl2FN3O4 |
|---|---|
| Molecular weight | 642.6 g/mol |
| InChIKey | YJCZPJQGFSSFOL-MNZPCBJKSA-N |
| SMILES | CCN1[C@H]([C@@H]([C@]2(C13CCCCC3)C4=C(C=C(C=C4)Cl)NC2=O)C5=C(C(=CC=C5)Cl)F)C(=O)NC67CCC(CC6)(CC7)C(=O)O |
Computed by PubChem (NCBI)