Products 181864-78-8

CAS 181864-78-8 appears in our catalog under these names: [2-(Dicyclohexylphosphino)ethyl]trimethylammonium chloride, 95%, 2-(Dicyclohexylphosphino)-N,N,N-trimethylethanaminium chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-dicyclohexylphosphanylethyl(trimethyl)azanium chloride (CAS 181864-78-8) is a chemical compound with the molecular formula C17H35ClNP and a molecular weight of 319.9 g/mol. IUPAC name: 2-dicyclohexylphosphanylethyl(trimethyl)azanium chloride. InChIKey: ADRQXJKZPSRURO-UHFFFAOYSA-M.

Identity
Molecular formulaC17H35ClNP
Molecular weight319.9 g/mol
IUPAC name2-dicyclohexylphosphanylethyl(trimethyl)azanium chloride
InChIKeyADRQXJKZPSRURO-UHFFFAOYSA-M
SMILESC[N+](C)(C)CCP(C1CCCCC1)C2CCCCC2.[Cl-]

Computed by PubChem (NCBI)