CAS 181952-24-9 appears in our catalog under these names: Fmoc–Tyr(SO₃H)–OH, Fmoc-L-Tyr(SO3H)-OH. Offered by: GLPBio, Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoic acid (CAS 181952-24-9) is a chemical compound with the molecular formula C24H21NO8S and a molecular weight of 483.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoic acid. InChIKey: CXMQJJASTSGJCK-QFIPXVFZSA-N.
| Molecular formula | C24H21NO8S |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-sulfooxyphenyl)propanoic acid |
| InChIKey | CXMQJJASTSGJCK-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=C(C=C4)OS(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)