CAS 1820023-27-5 is the registry number for (+)-Deoxyfebrifugine Dihydrobromide. Offered by: TRC. Available pack sizes: 100mg.
3-[2-oxo-3-[(2S)-piperidin-2-yl]propyl]quinazolin-4-one;dihydrobromide (CAS 1820023-27-5) is a chemical compound with the molecular formula C16H21Br2N3O2 and a molecular weight of 447.2 g/mol. IUPAC name: 3-[2-oxo-3-[(2S)-piperidin-2-yl]propyl]quinazolin-4-one;dihydrobromide. InChIKey: QPHKKLZDEXYOAQ-LTCKWSDVSA-N.
| Molecular formula | C16H21Br2N3O2 |
|---|---|
| Molecular weight | 447.2 g/mol |
| IUPAC name | 3-[2-oxo-3-[(2S)-piperidin-2-yl]propyl]quinazolin-4-one;dihydrobromide |
| InChIKey | QPHKKLZDEXYOAQ-LTCKWSDVSA-N |
| SMILES | C1CCN[C@@H](C1)CC(=O)CN2C=NC3=CC=CC=C3C2=O.Br.Br |
Computed by PubChem (NCBI)