CAS 18202-53-4 is the registry number for 6-(Pyrrolidin-1-yl)-9H-purin-2-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-pyrrolidin-1-yl-7H-purin-2-amine (CAS 18202-53-4) is a chemical compound with the molecular formula C9H12N6 and a molecular weight of 204.23 g/mol. IUPAC name: 6-pyrrolidin-1-yl-7H-purin-2-amine. InChIKey: BPUVBNMGJPXGHT-UHFFFAOYSA-N.
| Molecular formula | C9H12N6 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 6-pyrrolidin-1-yl-7H-purin-2-amine |
| InChIKey | BPUVBNMGJPXGHT-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC(=NC3=C2NC=N3)N |
Computed by PubChem (NCBI)