Products 18202-66-9
CAS 18202-66-9 appears in our catalog under these names: 6-tert-Butylpyrimidine-2,4-diol, 6-tert-Butylpyrimidine-2,4-diol, 95%, 6-Tert-butylpyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 1g, 100mg.
6-tert-butyl-1H-pyrimidine-2,4-dione (CAS 18202-66-9) is a chemical compound with the molecular formula C8H12N2O2 and a molecular weight of 168.19 g/mol. IUPAC name: 6-tert-butyl-1H-pyrimidine-2,4-dione. InChIKey: BFWDTJWBVUGSOT-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 6-tert-butyl-1H-pyrimidine-2,4-dione |
| InChIKey | BFWDTJWBVUGSOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)