CAS 1820569-07-0 appears in our catalog under these names: D-Fmoc-Ornithine hydrochloride, 96%, Fmoc-D-Orn-OH.HCl, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride (CAS 1820569-07-0) is a chemical compound with the molecular formula C20H23ClN2O4 and a molecular weight of 390.9 g/mol. IUPAC name: (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride. InChIKey: RGRQRWUUJPISQG-GMUIIQOCSA-N.
| Molecular formula | C20H23ClN2O4 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | (2R)-5-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid;hydrochloride |
| InChIKey | RGRQRWUUJPISQG-GMUIIQOCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)