Products 1820570-33-9
CAS 1820570-33-9 is the registry number for Rac-(1r,5s)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-7-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(1R,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-7-one (CAS 1820570-33-9) is a chemical compound with the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. IUPAC name: (1R,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-7-one. InChIKey: ZUPCKOVDCHXISZ-RQJHMYQMSA-N.
| Molecular formula | C8H14N2O |
|---|---|
| Molecular weight | 154.21 g/mol |
| IUPAC name | (1R,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-7-one |
| InChIKey | ZUPCKOVDCHXISZ-RQJHMYQMSA-N |
| SMILES | CN1[C@H]2CC[C@@H](C1=O)CNC2 |
Computed by PubChem (NCBI)