CAS 1820572-31-3 is the registry number for (2S)-2-amino-3-{[(tert-butoxy)carbonyl]amino}propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride (CAS 1820572-31-3) is a chemical compound with the molecular formula C8H17ClN2O4 and a molecular weight of 240.68 g/mol. IUPAC name: (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride. InChIKey: HANSCDCTUYPPIS-JEDNCBNOSA-N.
| Molecular formula | C8H17ClN2O4 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid;hydrochloride |
| InChIKey | HANSCDCTUYPPIS-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)