CAS 1820572-35-7 appears in our catalog under these names: Rac-(1r,2r,6s,7s)-4-azatricyclo[5.2.1.0(2,6)]decane hydrochloride, 95%, (3aR,4R,7S,7aS)-Octahydro-4,7-methano-1H-isoindole Hydrochloride, (3AR,4R,7S,7aS)-octahydro-1H-4,7-methanoisoindole hydrochloride, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 25mg, 50mg, 2,5g.
(1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane;hydrochloride (CAS 1820572-35-7) is a chemical compound with the molecular formula C9H16ClN and a molecular weight of 173.68 g/mol. IUPAC name: (1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane;hydrochloride. InChIKey: UHNBWKCSAOQKIY-JGJABSLASA-N.
| Molecular formula | C9H16ClN |
|---|---|
| Molecular weight | 173.68 g/mol |
| IUPAC name | (1S,2S,6R,7R)-4-azatricyclo[5.2.1.02,6]decane;hydrochloride |
| InChIKey | UHNBWKCSAOQKIY-JGJABSLASA-N |
| SMILES | C1C[C@H]2C[C@@H]1[C@@H]3[C@H]2CNC3.Cl |
Computed by PubChem (NCBI)