Products 1820574-61-5
CAS 1820574-61-5 is the registry number for methyl (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-3-(3-nitrophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoate (CAS 1820574-61-5) is a chemical compound with the molecular formula C25H22N2O6 and a molecular weight of 446.5 g/mol. IUPAC name: methyl (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoate. InChIKey: DLYLXCJYKOJUFH-HSZRJFAPSA-N.
| Molecular formula | C25H22N2O6 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | methyl (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoate |
| InChIKey | DLYLXCJYKOJUFH-HSZRJFAPSA-N |
| SMILES | COC(=O)C[C@H](C1=CC(=CC=C1)[N+](=O)[O-])NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)