CAS 1313054-82-8 is the registry number for Z-D-Asn(xan)-oh, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
(2R)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(9H-xanthen-9-ylamino)butanoic acid (CAS 1313054-82-8) is a chemical compound with the molecular formula C25H22N2O6 and a molecular weight of 446.5 g/mol. IUPAC name: (2R)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(9H-xanthen-9-ylamino)butanoic acid. InChIKey: UCGUJYWDGWXJFG-LJQANCHMSA-N.
| Molecular formula | C25H22N2O6 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | (2R)-4-oxo-2-(phenylmethoxycarbonylamino)-4-(9H-xanthen-9-ylamino)butanoic acid |
| InChIKey | UCGUJYWDGWXJFG-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CC(=O)NC2C3=CC=CC=C3OC4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)