CAS 1820574-87-5 is the registry number for Boc-D-2-aminobutanoic acid sodium salt, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g, 100g.
CAS 1820574-87-5 identifies a chemical compound with the molecular formula C9H17NNaO4 and a molecular weight of 226.23 g/mol. InChIKey: SEWUCGPKDGWTSI-FYZOBXCZSA-N.
| Molecular formula | C9H17NNaO4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| InChIKey | SEWUCGPKDGWTSI-FYZOBXCZSA-N |
| SMILES | CC[C@H](C(=O)O)NC(=O)OC(C)(C)C.[Na] |
Computed by PubChem (NCBI)