Products 1820579-36-9
CAS 1820579-36-9 appears in our catalog under these names: 5-tert-butyl 6-methyl (6S)-3H,4H,6H,7H-imidazo[4,5-c]pyridine-5,6-dicarboxylate, 96%, 5-tert-butyl 6-methyl (6S)-3H,4H,6H,7H-imidazo(4,5-c)pyridine-5,6-dicarboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-O-tert-butyl 6-O-methyl (6S)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5,6-dicarboxylate (CAS 1820579-36-9) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: 5-O-tert-butyl 6-O-methyl (6S)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5,6-dicarboxylate. InChIKey: LGMBOMJYCVXRBA-JTQLQIEISA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 5-O-tert-butyl 6-O-methyl (6S)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5,6-dicarboxylate |
| InChIKey | LGMBOMJYCVXRBA-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C[C@H]1C(=O)OC)N=CN2 |
Computed by PubChem (NCBI)