CAS 1609406-72-5 is the registry number for ([1-(2-Pyridinyl)-3-piperidinyl]methyl)amine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Oxalic acid;(1-pyridin-2-ylpiperidin-3-yl)methanamine (CAS 1609406-72-5) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. IUPAC name: oxalic acid;(1-pyridin-2-ylpiperidin-3-yl)methanamine. InChIKey: CHCSXGZHYGPTHO-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | oxalic acid;(1-pyridin-2-ylpiperidin-3-yl)methanamine |
| InChIKey | CHCSXGZHYGPTHO-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC=CC=N2)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)