CAS 1820579-87-0 is the registry number for tert-Butyl (2S,3R)-3-amino-6-oxo-[2,4'-bipiperidine]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-[(2S,3R)-3-amino-6-oxopiperidin-2-yl]piperidine-1-carboxylate (CAS 1820579-87-0) is a chemical compound with the molecular formula C15H27N3O3 and a molecular weight of 297.39 g/mol. IUPAC name: tert-butyl 4-[(2S,3R)-3-amino-6-oxopiperidin-2-yl]piperidine-1-carboxylate. InChIKey: AADBRYTVUFZUSW-YPMHNXCESA-N.
| Molecular formula | C15H27N3O3 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | tert-butyl 4-[(2S,3R)-3-amino-6-oxopiperidin-2-yl]piperidine-1-carboxylate |
| InChIKey | AADBRYTVUFZUSW-YPMHNXCESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)[C@H]2[C@@H](CCC(=O)N2)N |
Computed by PubChem (NCBI)