CAS 1820580-36-6 appears in our catalog under these names: Rac-(1s,5r)-9-methyl-3,9-diazabicyclo[3.3.2]decane dihydrochloride, 95%, Rac-(1S,5R)-9-methyl-3,9-diazabicyclo(3.3.2)decane dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.
(1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane;dihydrochloride (CAS 1820580-36-6) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: (1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane;dihydrochloride. InChIKey: FPNFBQMYWMVKEG-BPRGXCPLSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | (1S,5R)-9-methyl-3,9-diazabicyclo[3.3.2]decane;dihydrochloride |
| InChIKey | FPNFBQMYWMVKEG-BPRGXCPLSA-N |
| SMILES | CN1C[C@@H]2CCC[C@H]1CNC2.Cl.Cl |
Computed by PubChem (NCBI)