CAS 1820583-75-2 is the registry number for Boc-l-dab-otbu oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid (CAS 1820583-75-2) is a chemical compound with the molecular formula C15H28N2O8 and a molecular weight of 364.39 g/mol. IUPAC name: tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid. InChIKey: KIDMSCSLJSSMJG-FVGYRXGTSA-N.
| Molecular formula | C15H28N2O8 |
|---|---|
| Molecular weight | 364.39 g/mol |
| IUPAC name | tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;oxalic acid |
| InChIKey | KIDMSCSLJSSMJG-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCN)NC(=O)OC(C)(C)C.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)