CAS 1820590-21-3 is the registry number for 3-Fluoro-N-methanesulfonylbenzenecarboximidamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
3-fluoro-N'-methylsulfonylbenzenecarboximidamide (CAS 1820590-21-3) is a chemical compound with the molecular formula C8H9FN2O2S and a molecular weight of 216.23 g/mol. IUPAC name: 3-fluoro-N'-methylsulfonylbenzenecarboximidamide. InChIKey: ZZBQGQDFHHOKRT-UHFFFAOYSA-N.
| Molecular formula | C8H9FN2O2S |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | 3-fluoro-N'-methylsulfonylbenzenecarboximidamide |
| InChIKey | ZZBQGQDFHHOKRT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N=C(C1=CC(=CC=C1)F)N |
Computed by PubChem (NCBI)